C21H23NO8S — CID 42988319
[2-(4-methoxyphenyl)-2-oxoethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 42988319) has the molecular formula C21H23NO8S and a molecular weight of 449.48 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 42988319 |
| Molecular Formula | C21H23NO8S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | COc1ccc(C(=O)COC(=O)CCCNS(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C21H23NO8S/c1-27-16-6-4-15(5-7-16)18(23)14-30-21(24)3-2-10-22-31(25,26)17-8-9-19-20(13-17)29-12-11-28-19/h4-9,13,22H,2-3,10-12,14H2,1H3 |
| InChIKey | NDVRFUHMMDWBSU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|