C14H19NO6S — CID 43008756
ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 43008756) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 43008756 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | CCOC(=O)CCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H19NO6S/c1-2-19-14(16)4-3-7-15-22(17,18)11-5-6-12-13(10-11)21-9-8-20-12/h5-6,10,15H,2-4,7-9H2,1H3 |
| InChIKey | CODGZHXOULPJMS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|