C27H29N3O7S — CID 16560875
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate (PubChem CID 16560875) has the molecular formula C27H29N3O7S and a molecular weight of 539.61 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 16560875 |
| Molecular Formula | C27H29N3O7S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
| SMILES | N#CCCn1cc(C(=O)COC(=O)CCCCCNS(=O)(=O)c2ccc3c(c2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C27H29N3O7S/c28-12-6-14-30-18-22(21-7-3-4-8-23(21)30)24(31)19-37-27(32)9-2-1-5-13-29-38(33,34)20-10-11-25-26(17-20)36-16-15-35-25/h3-4,7-8,10-11,17-18,29H,1-2,5-6,9,13-16,19H2 |
| InChIKey | WTMIIAPMOQYTKZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|