C24H24N4O6S — CID 55403187
(4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 55403187) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 55403187 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | (4-cyano-3-methyl-1-phenylpyrazol-5-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | Cc1nn(-c2ccccc2)c(COC(=O)CCCNS(=O)(=O)c2ccc3c(c2)OCCO3)c1C#N |
| InChI | InChI=1S/C24H24N4O6S/c1-17-20(15-25)21(28(27-17)18-6-3-2-4-7-18)16-34-24(29)8-5-11-26-35(30,31)19-9-10-22-23(14-19)33-13-12-32-22/h2-4,6-7,9-10,14,26H,5,8,11-13,16H2,1H3 |
| InChIKey | RVNOWEFOKVNCKT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|