C19H19N3O7S2 — CID 55449486
(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 55449486) has the molecular formula C19H19N3O7S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 55449486 |
| Molecular Formula | C19H19N3O7S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)OCCO2)OCc1noc(-c2cccs2)n1 |
| InChI | InChI=1S/C19H19N3O7S2/c23-18(28-12-17-21-19(29-22-17)16-3-2-10-30-16)4-1-7-20-31(24,25)13-5-6-14-15(11-13)27-9-8-26-14/h2-3,5-6,10-11,20H,1,4,7-9,12H2 |
| InChIKey | UWFPEVAIYFIVKA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|