C22H26N2O7S2 — CID 55371090
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 55371090) has the molecular formula C22H26N2O7S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 55371090 |
| Molecular Formula | C22H26N2O7S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)OCCO2)OCC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C22H26N2O7S2/c25-21(24-10-2-4-17(24)20-5-3-13-32-20)15-31-22(26)6-1-9-23-33(27,28)16-7-8-18-19(14-16)30-12-11-29-18/h3,5,7-8,13-14,17,23H,1-2,4,6,9-12,15H2 |
| InChIKey | BERXVOHQQOGLPY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|