C21H25N3O6S2 — CID 55375113
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-morpholin-4-yl-5-sulfamoylbenzoate (PubChem CID 55375113) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-morpholin-4-yl-5-sulfamoylbenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-morpholin-4-yl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55375113 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 2-morpholin-4-yl-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)OCC(=O)N2CCCC2c2cccs2)c1 |
| InChI | InChI=1S/C21H25N3O6S2/c22-32(27,28)15-5-6-17(23-8-10-29-11-9-23)16(13-15)21(26)30-14-20(25)24-7-1-3-18(24)19-4-2-12-31-19/h2,4-6,12-13,18H,1,3,7-11,14H2,(H2,22,27,28) |
| InChIKey | PCTNTAIPZFTXOV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |