C19H22N2O5S2 — CID 55371209
[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 55371209) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55371209 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)OCC(=O)N2CCCC2c2cccs2)c1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-20(2)28(24,25)15-7-3-6-14(12-15)19(23)26-13-18(22)21-10-4-8-16(21)17-9-5-11-27-17/h3,5-7,9,11-12,16H,4,8,10,13H2,1-2H3 |
| InChIKey | AUCGUBYSIVJMHN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |