C20H28N2O6S — CID 11930617
[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 11930617) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 11930617 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)OCC(=O)N2CCC[C@@H]3CCCC[C@@H]32)c1 |
| InChI | InChI=1S/C20H28N2O6S/c1-21(27-2)29(25,26)17-10-5-8-16(13-17)20(24)28-14-19(23)22-12-6-9-15-7-3-4-11-18(15)22/h5,8,10,13,15,18H,3-4,6-7,9,11-12,14H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | QXMHJFRVIKEOMN-YJBOKZPZSA-N |
| XLogP | 2.21 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|