C20H27NO5 — CID 9200513
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3,4-dimethoxybenzoate (PubChem CID 9200513) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 9200513 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N2CCC[C@H]3CCCC[C@H]32)cc1OC |
| InChI | InChI=1S/C20H27NO5/c1-24-17-10-9-15(12-18(17)25-2)20(23)26-13-19(22)21-11-5-7-14-6-3-4-8-16(14)21/h9-10,12,14,16H,3-8,11,13H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | XPLJZJQBPIRLAH-GDBMZVCRSA-N |
| XLogP | 3.04 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |