C18H24N2O3 — CID 8566227
4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]benzamide (PubChem CID 8566227) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]benzamide.
| Compound Name | 4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 8566227 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCC(=O)N2CCC[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C18H24N2O3/c19-18(22)14-7-9-15(10-8-14)23-12-17(21)20-11-3-5-13-4-1-2-6-16(13)20/h7-10,13,16H,1-6,11-12H2,(H2,19,22)/t13-,16-/m0/s1 |
| InChIKey | DYXNCPRNNPCLGW-BBRMVZONSA-N |
| XLogP | 2.35 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |