C19H23N3O3 — CID 51726338
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]ethanone (PubChem CID 51726338) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 51726338 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]ethanone |
| SMILES | O=C(COc1ccc(-c2nnco2)cc1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H23N3O3/c23-18(22-11-3-5-14-4-1-2-6-17(14)22)12-24-16-9-7-15(8-10-16)19-21-20-13-25-19/h7-10,13-14,17H,1-6,11-12H2/t14-,17-/m1/s1 |
| InChIKey | JVOUXNLCCVOKMU-RHSMWYFYSA-N |
| XLogP | 3.30 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |