C20H23NO4 — CID 8882275
7-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 8882275) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 7-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 8882275 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 7-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H23NO4/c22-19(21-11-3-5-14-4-1-2-6-17(14)21)13-24-16-9-7-15-8-10-20(23)25-18(15)12-16/h7-10,12,14,17H,1-6,11,13H2/t14-,17-/m0/s1 |
| InChIKey | NRNCKISNXOBUTG-YOEHRIQHSA-N |
| XLogP | 3.35 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|