C17H20N2O4 — CID 78769592
7-[2-(4-methyl-1,4-diazepan-1-yl)-2-oxoethoxy]chromen-2-one (PubChem CID 78769592) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 7-[2-(4-methyl-1,4-diazepan-1-yl)-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-(4-methyl-1,4-diazepan-1-yl)-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 78769592 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 7-[2-(4-methyl-1,4-diazepan-1-yl)-2-oxoethoxy]chromen-2-one |
| SMILES | CN1CCCN(C(=O)COc2ccc3ccc(=O)oc3c2)CC1 |
| InChI | InChI=1S/C17H20N2O4/c1-18-7-2-8-19(10-9-18)16(20)12-22-14-5-3-13-4-6-17(21)23-15(13)11-14/h3-6,11H,2,7-10,12H2,1H3 |
| InChIKey | NJBPVZWOZYUQAJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|