C15H17ClN2O4 — CID 119412010
7-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride (PubChem CID 119412010) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is 7-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride.
| Compound Name | 7-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 119412010 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 7-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)COc2ccc3ccc(=O)oc3c2)C1 |
| InChI | InChI=1S/C15H16N2O4.ClH/c16-11-5-6-17(8-11)14(18)9-20-12-3-1-10-2-4-15(19)21-13(10)7-12;/h1-4,7,11H,5-6,8-9,16H2;1H/t11-;/m1./s1 |
| InChIKey | SGQRZYYZJMXQLL-RFVHGSKJSA-N |
| XLogP | 1.15 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|