C17H21ClN2O4 — CID 120807788
7-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride (PubChem CID 120807788) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is 7-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride.
| Compound Name | 7-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 120807788 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 7-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one;hydrochloride |
| SMILES | CC1(CN)CCN(C(=O)COc2ccc3ccc(=O)oc3c2)C1.Cl |
| InChI | InChI=1S/C17H20N2O4.ClH/c1-17(10-18)6-7-19(11-17)15(20)9-22-13-4-2-12-3-5-16(21)23-14(12)8-13;/h2-5,8H,6-7,9-11,18H2,1H3;1H |
| InChIKey | GRKQAIXNBZFQRD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|