C21H26N2O5 — CID 171909951
7-[2-[(6S,11S)-11-hydroxy-8-methyl-2,8-diazaspiro[5.5]undecan-2-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 171909951) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 7-[2-[(6S,11S)-11-hydroxy-8-methyl-2,8-diazaspiro[5.5]undecan-2-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[(6S,11S)-11-hydroxy-8-methyl-2,8-diazaspiro[5.5]undecan-2-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171909951 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 7-[2-[(6S,11S)-11-hydroxy-8-methyl-2,8-diazaspiro[5.5]undecan-2-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | CN1CC[C@H](O)[C@@]2(CCCN(C(=O)COc3ccc4ccc(=O)oc4c3)C2)C1 |
| InChI | InChI=1S/C21H26N2O5/c1-22-10-7-18(24)21(13-22)8-2-9-23(14-21)19(25)12-27-16-5-3-15-4-6-20(26)28-17(15)11-16/h3-6,11,18,24H,2,7-10,12-14H2,1H3/t18-,21-/m0/s1 |
| InChIKey | HEUXQDGLRCIUSH-RXVVDRJESA-N |
| XLogP | 1.48 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|