C23H19ClN2O5 — CID 55866745
7-[2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 55866745) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is 7-[2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 55866745 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 7-[2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CCC(c2nc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C23H19ClN2O5/c24-16-3-5-19-18(11-16)25-23(31-19)15-7-9-26(10-8-15)21(27)13-29-17-4-1-14-2-6-22(28)30-20(14)12-17/h1-6,11-12,15H,7-10,13H2 |
| InChIKey | RMOOPOSBTMDUCZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|