C20H24N2O4 — CID 134020445
7-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethoxy]chromen-2-one (PubChem CID 134020445) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 7-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 134020445 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 7-[2-(4-cyclopentylpiperazin-1-yl)-2-oxoethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C20H24N2O4/c23-19(22-11-9-21(10-12-22)16-3-1-2-4-16)14-25-17-7-5-15-6-8-20(24)26-18(15)13-17/h5-8,13,16H,1-4,9-12,14H2 |
| InChIKey | POJGXFOQSNLXBZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|