C21H20N2O6 — CID 171387315
7-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 171387315) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 7-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171387315 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 7-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CCCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H20N2O6/c24-19(14-28-16-6-4-15-5-7-20(25)29-18(15)13-16)22-8-2-9-23(11-10-22)21(26)17-3-1-12-27-17/h1,3-7,12-13H,2,8-11,14H2 |
| InChIKey | UQFZKRDOHMDCMA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|