C23H22N2O6 — CID 171386257
1-[(3-methoxyphenyl)methyl]-4-[2-(2-oxochromen-7-yl)oxyacetyl]piperazin-2-one (PubChem CID 171386257) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-4-[2-(2-oxochromen-7-yl)oxyacetyl]piperazin-2-one.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-4-[2-(2-oxochromen-7-yl)oxyacetyl]piperazin-2-one |
|---|---|
| PubChem CID | 171386257 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-4-[2-(2-oxochromen-7-yl)oxyacetyl]piperazin-2-one |
| SMILES | COc1cccc(CN2CCN(C(=O)COc3ccc4ccc(=O)oc4c3)CC2=O)c1 |
| InChI | InChI=1S/C23H22N2O6/c1-29-18-4-2-3-16(11-18)13-24-9-10-25(14-21(24)26)22(27)15-30-19-7-5-17-6-8-23(28)31-20(17)12-19/h2-8,11-12H,9-10,13-15H2,1H3 |
| InChIKey | PTEMUCKLUSLBEJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|