C15H19N7O3 — CID 86284780
4-[2-(5-aminotetrazol-1-yl)acetyl]-1-[(3-methoxyphenyl)methyl]piperazin-2-one (PubChem CID 86284780) has the molecular formula C15H19N7O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 4-[2-(5-aminotetrazol-1-yl)acetyl]-1-[(3-methoxyphenyl)methyl]piperazin-2-one.
| Compound Name | 4-[2-(5-aminotetrazol-1-yl)acetyl]-1-[(3-methoxyphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 86284780 |
| Molecular Formula | C15H19N7O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-[2-(5-aminotetrazol-1-yl)acetyl]-1-[(3-methoxyphenyl)methyl]piperazin-2-one |
| SMILES | COc1cccc(CN2CCN(C(=O)Cn3nnnc3N)CC2=O)c1 |
| InChI | InChI=1S/C15H19N7O3/c1-25-12-4-2-3-11(7-12)8-20-5-6-21(9-13(20)23)14(24)10-22-15(16)17-18-19-22/h2-4,7H,5-6,8-10H2,1H3,(H2,16,17,19) |
| InChIKey | LKXPITVIZZRVDT-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |