C20H24N2O3 — CID 780106
1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-phenoxyethanone (PubChem CID 780106) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 780106 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-2-phenoxyethanone |
| SMILES | COc1cccc(CN2CCN(C(=O)COc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-24-19-9-5-6-17(14-19)15-21-10-12-22(13-11-21)20(23)16-25-18-7-3-2-4-8-18/h2-9,14H,10-13,15-16H2,1H3 |
| InChIKey | LFDYFJCCPYLTRS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |