C19H20Cl2N2O2 — CID 22264923
1-(4-benzylpiperazin-1-yl)-2-(3,5-dichlorophenoxy)ethanone (PubChem CID 22264923) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(3,5-dichlorophenoxy)ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(3,5-dichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 22264923 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(3,5-dichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-16-10-17(21)12-18(11-16)25-14-19(24)23-8-6-22(7-9-23)13-15-4-2-1-3-5-15/h1-5,10-12H,6-9,13-14H2 |
| InChIKey | FCFDCVFKSTUOIT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |