C13H13Cl2NO3 — CID 39425847
1-[2-(3,5-dichlorophenoxy)acetyl]piperidin-4-one (PubChem CID 39425847) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenoxy)acetyl]piperidin-4-one.
| Compound Name | 1-[2-(3,5-dichlorophenoxy)acetyl]piperidin-4-one |
|---|---|
| PubChem CID | 39425847 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-[2-(3,5-dichlorophenoxy)acetyl]piperidin-4-one |
| SMILES | O=C1CCN(C(=O)COc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H13Cl2NO3/c14-9-5-10(15)7-12(6-9)19-8-13(18)16-3-1-11(17)2-4-16/h5-7H,1-4,8H2 |
| InChIKey | ALUGZBQRXGSLDB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |