C17H19NO5 — CID 171907125
7-[2-(3-ethoxypyrrolidin-1-yl)-2-oxoethoxy]chromen-2-one (PubChem CID 171907125) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 7-[2-(3-ethoxypyrrolidin-1-yl)-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-(3-ethoxypyrrolidin-1-yl)-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171907125 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 7-[2-(3-ethoxypyrrolidin-1-yl)-2-oxoethoxy]chromen-2-one |
| SMILES | CCOC1CCN(C(=O)COc2ccc3ccc(=O)oc3c2)C1 |
| InChI | InChI=1S/C17H19NO5/c1-2-21-14-7-8-18(10-14)16(19)11-22-13-5-3-12-4-6-17(20)23-15(12)9-13/h3-6,9,14H,2,7-8,10-11H2,1H3 |
| InChIKey | NVVYCDQKDVTVEP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|