C23H23NO6 — CID 171387457
7-[2-[3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 171387457) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is 7-[2-[3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171387457 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 7-[2-[3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | COc1cccc(C2CCN(C(=O)COc3ccc4ccc(=O)oc4c3)C2)c1OC |
| InChI | InChI=1S/C23H23NO6/c1-27-19-5-3-4-18(23(19)28-2)16-10-11-24(13-16)21(25)14-29-17-8-6-15-7-9-22(26)30-20(15)12-17/h3-9,12,16H,10-11,13-14H2,1-2H3 |
| InChIKey | OGKXKMGKTZLJJX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|