C21H19NO5 — CID 55632311
7-[2-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one (PubChem CID 55632311) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 7-[2-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 55632311 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 7-[2-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one |
| SMILES | COc1cccc2c1N(C(=O)COc1ccc3ccc(=O)oc3c1)CCC2 |
| InChI | InChI=1S/C21H19NO5/c1-25-17-6-2-4-15-5-3-11-22(21(15)17)19(23)13-26-16-9-7-14-8-10-20(24)27-18(14)12-16/h2,4,6-10,12H,3,5,11,13H2,1H3 |
| InChIKey | JXWAYDNLRHGZBC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|