C12H14BrNO2 — CID 63681436
2-bromo-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 63681436) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 2-bromo-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-bromo-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 63681436 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-bromo-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | COc1cccc2c1N(C(=O)CBr)CCC2 |
| InChI | InChI=1S/C12H14BrNO2/c1-16-10-6-2-4-9-5-3-7-14(12(9)10)11(15)8-13/h2,4,6H,3,5,7-8H2,1H3 |
| InChIKey | VWHPINVZDXLAQT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|