C15H22N2O2 — CID 54876805
2-amino-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)pentan-1-one (PubChem CID 54876805) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-amino-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)pentan-1-one.
| Compound Name | 2-amino-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 54876805 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-amino-1-(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)pentan-1-one |
| SMILES | CCCC(N)C(=O)N1CCCc2cccc(OC)c21 |
| InChI | InChI=1S/C15H22N2O2/c1-3-6-12(16)15(18)17-10-5-8-11-7-4-9-13(19-2)14(11)17/h4,7,9,12H,3,5-6,8,10,16H2,1-2H3 |
| InChIKey | FHBKRBSDHDXKGH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |