C21H19NO4 — CID 51289110
7-[2-(8-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one (PubChem CID 51289110) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 7-[2-(8-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-(8-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 51289110 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 7-[2-(8-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one |
| SMILES | Cc1cccc2c1N(C(=O)COc1ccc3ccc(=O)oc3c1)CCC2 |
| InChI | InChI=1S/C21H19NO4/c1-14-4-2-5-16-6-3-11-22(21(14)16)19(23)13-25-17-9-7-15-8-10-20(24)26-18(15)12-17/h2,4-5,7-10,12H,3,6,11,13H2,1H3 |
| InChIKey | QRXXZTSPCKCXGW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|