C21H18F2N2O6S — CID 55389703
7-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 55389703) has the molecular formula C21H18F2N2O6S and a molecular weight of 464.45 g/mol. Its IUPAC name is 7-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 55389703 |
| Molecular Formula | C21H18F2N2O6S |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 7-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C21H18F2N2O6S/c22-15-3-5-17(23)19(11-15)32(28,29)25-9-7-24(8-10-25)20(26)13-30-16-4-1-14-2-6-21(27)31-18(14)12-16/h1-6,11-12H,7-10,13H2 |
| InChIKey | XQZDLRVDEJFRSU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|