C21H26N2O5 — CID 171389529
7-[2-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 171389529) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 7-[2-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171389529 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 7-[2-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CCCCC1CN1CCOCC1 |
| InChI | InChI=1S/C21H26N2O5/c24-20(15-27-18-6-4-16-5-7-21(25)28-19(16)13-18)23-8-2-1-3-17(23)14-22-9-11-26-12-10-22/h4-7,13,17H,1-3,8-12,14-15H2 |
| InChIKey | SGLHRKKTPIPGRX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|