C20H27N3O2 — CID 97143198
2-indol-1-yl-1-[(2S)-2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 97143198) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-indol-1-yl-1-[(2S)-2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-indol-1-yl-1-[(2S)-2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97143198 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-indol-1-yl-1-[(2S)-2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(Cn1ccc2ccccc21)N1CCCC[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C20H27N3O2/c24-20(16-22-10-8-17-5-1-2-7-19(17)22)23-9-4-3-6-18(23)15-21-11-13-25-14-12-21/h1-2,5,7-8,10,18H,3-4,6,9,11-16H2/t18-/m0/s1 |
| InChIKey | SNJXINBESPYRDE-SFHVURJKSA-N |
| XLogP | 2.35 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |