C19H28N2O2S — CID 70755072
2-(4-methylsulfanylphenyl)-1-[2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 70755072) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenyl)-1-[2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-methylsulfanylphenyl)-1-[2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70755072 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-(4-methylsulfanylphenyl)-1-[2-(morpholin-4-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | CSc1ccc(CC(=O)N2CCCCC2CN2CCOCC2)cc1 |
| InChI | InChI=1S/C19H28N2O2S/c1-24-18-7-5-16(6-8-18)14-19(22)21-9-3-2-4-17(21)15-20-10-12-23-13-11-20/h5-8,17H,2-4,9-15H2,1H3 |
| InChIKey | UIRODIDCMCCBMK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |