C20H20N2O6 — CID 171915197
(1S,5R)-4-[2-(2-oxochromen-7-yl)oxyacetyl]-12-oxa-4,8-diazatricyclo[6.4.0.01,5]dodecan-7-one (PubChem CID 171915197) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is (1S,5R)-4-[2-(2-oxochromen-7-yl)oxyacetyl]-12-oxa-4,8-diazatricyclo[6.4.0.01,5]dodecan-7-one.
| Compound Name | (1S,5R)-4-[2-(2-oxochromen-7-yl)oxyacetyl]-12-oxa-4,8-diazatricyclo[6.4.0.01,5]dodecan-7-one |
|---|---|
| PubChem CID | 171915197 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (1S,5R)-4-[2-(2-oxochromen-7-yl)oxyacetyl]-12-oxa-4,8-diazatricyclo[6.4.0.01,5]dodecan-7-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CC[C@@]23OCCCN2C(=O)C[C@@H]13 |
| InChI | InChI=1S/C20H20N2O6/c23-17-11-16-20(22(17)7-1-9-27-20)6-8-21(16)18(24)12-26-14-4-2-13-3-5-19(25)28-15(13)10-14/h2-5,10,16H,1,6-9,11-12H2/t16-,20+/m1/s1 |
| InChIKey | WCSOYLSJMAMFID-UZLBHIALSA-N |
| XLogP | 1.12 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|