C24H23NO6 — CID 40772831
7-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 40772831) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is 7-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 40772831 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 7-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)N1CCC[C@@H]1c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H23NO6/c26-23(15-30-18-7-4-16-6-9-24(27)31-21(16)14-18)25-10-1-3-19(25)17-5-8-20-22(13-17)29-12-2-11-28-20/h4-9,13-14,19H,1-3,10-12,15H2/t19-/m1/s1 |
| InChIKey | ZKKKPZQJGYVXMJ-LJQANCHMSA-N |
| XLogP | 3.70 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|