C19H23NO4 — CID 134004095
N-methyl-N-(2-methylcyclohexyl)-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 134004095) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-methyl-N-(2-methylcyclohexyl)-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-methyl-N-(2-methylcyclohexyl)-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 134004095 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-methyl-N-(2-methylcyclohexyl)-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | CC1CCCCC1N(C)C(=O)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C19H23NO4/c1-13-5-3-4-6-16(13)20(2)18(21)12-23-15-9-7-14-8-10-19(22)24-17(14)11-15/h7-11,13,16H,3-6,12H2,1-2H3 |
| InChIKey | LCOFLOSGBKALDD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|