C24H30O5 — CID 163193804
(Z)-2-methyl-3-[(2-oxochromen-7-yl)oxymethyl]-4-[(1R,6S)-2,2,6-trimethylcyclohexyl]but-2-enoic acid (PubChem CID 163193804) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (Z)-2-methyl-3-[(2-oxochromen-7-yl)oxymethyl]-4-[(1R,6S)-2,2,6-trimethylcyclohexyl]but-2-enoic acid.
| Compound Name | (Z)-2-methyl-3-[(2-oxochromen-7-yl)oxymethyl]-4-[(1R,6S)-2,2,6-trimethylcyclohexyl]but-2-enoic acid |
|---|---|
| PubChem CID | 163193804 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (Z)-2-methyl-3-[(2-oxochromen-7-yl)oxymethyl]-4-[(1R,6S)-2,2,6-trimethylcyclohexyl]but-2-enoic acid |
| SMILES | C/C(C(=O)O)=C(/COc1ccc2ccc(=O)oc2c1)C[C@@H]1[C@@H](C)CCCC1(C)C |
| InChI | InChI=1S/C24H30O5/c1-15-6-5-11-24(3,4)20(15)12-18(16(2)23(26)27)14-28-19-9-7-17-8-10-22(25)29-21(17)13-19/h7-10,13,15,20H,5-6,11-12,14H2,1-4H3,(H,26,27)/b18-16-/t15-,20+/m0/s1 |
| InChIKey | ZSFLXSGCJQTJDF-MGTIBEPZSA-N |
| XLogP | 5.43 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|