C23H30O5 — CID 163057636
7-[(2,6-dihydroxy-2,5,8a-trimethyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl)methoxy]chromen-2-one (PubChem CID 163057636) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 7-[(2,6-dihydroxy-2,5,8a-trimethyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl)methoxy]chromen-2-one.
| Compound Name | 7-[(2,6-dihydroxy-2,5,8a-trimethyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 163057636 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 7-[(2,6-dihydroxy-2,5,8a-trimethyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-1-yl)methoxy]chromen-2-one |
| SMILES | CC1C(O)CCC2(C)C1CCC(C)(O)C2COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C23H30O5/c1-14-17-8-11-23(3,26)20(22(17,2)10-9-18(14)24)13-27-16-6-4-15-5-7-21(25)28-19(15)12-16/h4-7,12,14,17-18,20,24,26H,8-11,13H2,1-3H3 |
| InChIKey | BWPMRIBVJPREMT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|