C24H32O4 — CID 73241696
7-[(6-hydroxy-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl)methoxy]chromen-2-one (PubChem CID 73241696) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is 7-[(6-hydroxy-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl)methoxy]chromen-2-one.
| Compound Name | 7-[(6-hydroxy-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 73241696 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 7-[(6-hydroxy-1,2,4a,5-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl)methoxy]chromen-2-one |
| SMILES | CC1CCC2(C)C(C)C(O)CCC2C1(C)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C24H32O4/c1-15-11-12-23(3)16(2)19(25)8-9-21(23)24(15,4)14-27-18-7-5-17-6-10-22(26)28-20(17)13-18/h5-7,10,13,15-16,19,21,25H,8-9,11-12,14H2,1-4H3 |
| InChIKey | VZHMLYJMPGDZPE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|