C24H30O6 — CID 23267023
3-[2,2,5,6-tetramethyl-5-[(2-oxochromen-7-yl)oxymethyl]-1-oxaspiro[2.5]octan-4-yl]propanoic acid (PubChem CID 23267023) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-[2,2,5,6-tetramethyl-5-[(2-oxochromen-7-yl)oxymethyl]-1-oxaspiro[2.5]octan-4-yl]propanoic acid.
| Compound Name | 3-[2,2,5,6-tetramethyl-5-[(2-oxochromen-7-yl)oxymethyl]-1-oxaspiro[2.5]octan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 23267023 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[2,2,5,6-tetramethyl-5-[(2-oxochromen-7-yl)oxymethyl]-1-oxaspiro[2.5]octan-4-yl]propanoic acid |
| SMILES | CC1CCC2(OC2(C)C)C(CCC(=O)O)C1(C)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C24H30O6/c1-15-11-12-24(22(2,3)30-24)19(8-9-20(25)26)23(15,4)14-28-17-7-5-16-6-10-21(27)29-18(16)13-17/h5-7,10,13,15,19H,8-9,11-12,14H2,1-4H3,(H,25,26) |
| InChIKey | YMRLNOVONLFNJX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|