C36H50O15 — CID 4203035
[6-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propanoate (PubChem CID 4203035) has the molecular formula C36H50O15 and a molecular weight of 722.78 g/mol. Its IUPAC name is [6-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propanoate.
| Compound Name | [6-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propanoate |
|---|---|
| PubChem CID | 4203035 |
| Molecular Formula | C36H50O15 |
| Molecular Weight | 722.78 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | [6-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propanoate |
| SMILES | CC(C)=C1CCC(C)C(C)(COc2ccc3ccc(=O)oc3c2)C1CCC(=O)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C36H50O15/c1-18(2)22-9-5-19(3)35(4,17-47-21-8-6-20-7-11-28(40)48-24(20)13-21)23(22)10-12-27(39)46-15-26-29(41)31(43)32(44)34(49-26)51-36(16-38)33(45)30(42)25(14-37)50-36/h6-8,11,13,19,23,25-26,29-34,37-38,41-45H,5,9-10,12,14-17H2,1-4H3 |
| InChIKey | MODRONMXUPECIK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 235.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.78 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|