About 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate
3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate (PubChem CID 23265627) has the molecular formula C26H34O5
and a molecular weight of 426.55 g/mol. Its IUPAC name is 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate.
Molecular Properties
| Compound Name | 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate |
| PubChem CID | 23265627 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate |
| SMILES | CC(=O)OCCCC1C(=C(C)C)CCC(C)C1(C)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C26H34O5/c1-17(2)22-12-8-18(3)26(5,23(22)7-6-14-29-19(4)27)16-30-21-11-9-20-10-13-25(28)31-24(20)15-21/h9-11,13,15,18,23H,6-8,12,14,16H2,1-5H3 |
| InChIKey | RXZXZUBVBUVUGS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate?
The IUPAC name of 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate (CID 23265627) is 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate.
What is the SMILES notation for 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate?
The canonical SMILES for 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate is CC(=O)OCCCC1C(=C(C)C)CCC(C)C1(C)COc1ccc2ccc(=O)oc2c1.
What is the InChIKey of 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate?
The InChIKey is RXZXZUBVBUVUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34O5/c1-17(2)22-12-8-18(3)26(5,23(22)7-6-14-29-19(4)27)16-30-21-11-9-20-10-13-25(28)31-24(20)15-21/h9-11,13,15,18,23H,6-8,12,14,16H2,1-5H3.
What are the key properties of 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate?
3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate has a molecular weight of 426.55 g/mol, XLogP of 5.90, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propyl acetate is sourced from PubChem (CID 23265627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).