C19H22O6 — CID 122148536
ethyl 4-hydroxy-4-[(2-oxochromen-7-yl)oxymethyl]cyclohexane-1-carboxylate (PubChem CID 122148536) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[(2-oxochromen-7-yl)oxymethyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-[(2-oxochromen-7-yl)oxymethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 122148536 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | ethyl 4-hydroxy-4-[(2-oxochromen-7-yl)oxymethyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(COc2ccc3ccc(=O)oc3c2)CC1 |
| InChI | InChI=1S/C19H22O6/c1-2-23-18(21)14-7-9-19(22,10-8-14)12-24-15-5-3-13-4-6-17(20)25-16(13)11-15/h3-6,11,14,22H,2,7-10,12H2,1H3 |
| InChIKey | UZLMNOUUKOHEIX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|