C19H21NO8S — CID 55304815
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55304815) has the molecular formula C19H21NO8S and a molecular weight of 423.44 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55304815 |
| Molecular Formula | C19H21NO8S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | CCN(C(=O)COC(=O)COc1ccc2ccc(=O)oc2c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21NO8S/c1-2-20(14-7-8-29(24,25)12-14)17(21)10-27-19(23)11-26-15-5-3-13-4-6-18(22)28-16(13)9-15/h3-6,9,14H,2,7-8,10-12H2,1H3 |
| InChIKey | RFJXKFJADNEBSH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|