C23H23NO8S — CID 55304913
[2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55304913) has the molecular formula C23H23NO8S and a molecular weight of 473.50 g/mol. Its IUPAC name is [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55304913 |
| Molecular Formula | C23H23NO8S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(C(=O)COC(=O)COc2ccc3ccc(=O)oc3c2)c(C)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H23NO8S/c1-14-9-19(15(2)24(14)17-7-8-33(28,29)13-17)20(25)11-31-23(27)12-30-18-5-3-16-4-6-22(26)32-21(16)10-18/h3-6,9-10,17H,7-8,11-13H2,1-2H3 |
| InChIKey | UGIIVIUMDJZIKW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 121.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|