C22H22N2O6S — CID 46815666
[2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate (PubChem CID 46815666) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate.
| Compound Name | [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46815666 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C=C/c2nc3ccccc3o2)c(C)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H22N2O6S/c1-14-11-17(15(2)24(14)16-9-10-31(27,28)13-16)19(25)12-29-22(26)8-7-21-23-18-5-3-4-6-20(18)30-21/h3-8,11,16H,9-10,12-13H2,1-2H3/b8-7+ |
| InChIKey | YUEFWKGAENUERO-BQYQJAHWSA-N |
| XLogP | 3.05 |
| TPSA | 108.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|