C24H24N2O5S — CID 16617842
[2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16617842) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16617842 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [2-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | Cc1cc(C(=O)COC(=O)/C=C/c2cccc3cccnc23)c(C)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H24N2O5S/c1-16-13-21(17(2)26(16)20-10-12-32(29,30)15-20)22(27)14-31-23(28)9-8-19-6-3-5-18-7-4-11-25-24(18)19/h3-9,11,13,20H,10,12,14-15H2,1-2H3/b9-8+ |
| InChIKey | LSJOPLGCKCJLPE-CMDGGOBGSA-N |
| XLogP | 3.45 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|