C17H20N2O4S — CID 112978632
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-quinolin-6-yloxyacetamide (PubChem CID 112978632) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-quinolin-6-yloxyacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-quinolin-6-yloxyacetamide |
|---|---|
| PubChem CID | 112978632 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-quinolin-6-yloxyacetamide |
| SMILES | CCN(C(=O)COc1ccc2ncccc2c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20N2O4S/c1-2-19(14-7-9-24(21,22)12-14)17(20)11-23-15-5-6-16-13(10-15)4-3-8-18-16/h3-6,8,10,14H,2,7,9,11-12H2,1H3 |
| InChIKey | RBSCRWXYNDPVAZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |